About [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide
[(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide (PubChem CID 70681236) has the molecular formula C13H24ClIN6O
and a molecular weight of 442.73 g/mol. Its IUPAC name is [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide.
Molecular Properties
| Compound Name | [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide |
| PubChem CID | 70681236 |
| Molecular Formula | C13H24ClIN6O |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide |
| SMILES | CC(C)[C@@H](CNC(=O)c1nc(Cl)c(N)nc1N)[N+](C)(C)C.[I-] |
| InChI | InChI=1S/C13H23ClN6O.HI/c1-7(2)8(20(3,4)5)6-17-13(21)9-11(15)19-12(16)10(14)18-9;/h7-8H,6H2,1-5H3,(H4-,15,16,17,19,21);1H/t8-;/m1./s1 |
| InChIKey | NSHAALXYSRHCBT-DDWIOCJRSA-N |
| XLogP | -2.24 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide?
The IUPAC name of [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide (CID 70681236) is [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide.
What is the SMILES notation for [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide?
The canonical SMILES for [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide is CC(C)[C@@H](CNC(=O)c1nc(Cl)c(N)nc1N)[N+](C)(C)C.[I-].
What is the InChIKey of [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide?
The InChIKey is NSHAALXYSRHCBT-DDWIOCJRSA-N. The full InChI is InChI=1S/C13H23ClN6O.HI/c1-7(2)8(20(3,4)5)6-17-13(21)9-11(15)19-12(16)10(14)18-9;/h7-8H,6H2,1-5H3,(H4-,15,16,17,19,21);1H/t8-;/m1./s1.
What are the key properties of [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide?
[(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide has a molecular weight of 442.73 g/mol, XLogP of -2.24, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]-3-methylbutan-2-yl]-trimethylazanium iodide is sourced from PubChem (CID 70681236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).