C24H20F3N9O2S — CID 70681257
4-[[[6-[4-(1,2,4-triazol-1-yl)phenyl]-4-(2,2,2-trifluoroethylamino)pyrido[3,2-d]pyrimidin-2-yl]amino]methyl]benzenesulfonamide (PubChem CID 70681257) has the molecular formula C24H20F3N9O2S and a molecular weight of 555.55 g/mol. Its IUPAC name is 4-[[[6-[4-(1,2,4-triazol-1-yl)phenyl]-4-(2,2,2-trifluoroethylamino)pyrido[3,2-d]pyrimidin-2-yl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[6-[4-(1,2,4-triazol-1-yl)phenyl]-4-(2,2,2-trifluoroethylamino)pyrido[3,2-d]pyrimidin-2-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70681257 |
| Molecular Formula | C24H20F3N9O2S |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 4-[[[6-[4-(1,2,4-triazol-1-yl)phenyl]-4-(2,2,2-trifluoroethylamino)pyrido[3,2-d]pyrimidin-2-yl]amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNc2nc(NCC(F)(F)F)c3nc(-c4ccc(-n5cncn5)cc4)ccc3n2)cc1 |
| InChI | InChI=1S/C24H20F3N9O2S/c25-24(26,27)12-31-22-21-20(34-23(35-22)30-11-15-1-7-18(8-2-15)39(28,37)38)10-9-19(33-21)16-3-5-17(6-4-16)36-14-29-13-32-36/h1-10,13-14H,11-12H2,(H2,28,37,38)(H2,30,31,34,35) |
| InChIKey | HOSNYZASEJFPOZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 153.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |