C21H21NO3 — CID 70681411
(2R,8aR)-2-hydroxy-7-(4-methoxyphenyl)-6-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 70681411) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (2R,8aR)-2-hydroxy-7-(4-methoxyphenyl)-6-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | (2R,8aR)-2-hydroxy-7-(4-methoxyphenyl)-6-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 70681411 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (2R,8aR)-2-hydroxy-7-(4-methoxyphenyl)-6-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | COc1ccc(C2=C(c3ccccc3)C(=O)N3C[C@H](O)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-25-18-9-7-14(8-10-18)19-12-16-11-17(23)13-22(16)21(24)20(19)15-5-3-2-4-6-15/h2-10,16-17,23H,11-13H2,1H3/t16-,17+/m0/s1 |
| InChIKey | RQOKGCFPMUUDJW-DLBZAZTESA-N |
| XLogP | 2.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|