About (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide
(E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide (PubChem CID 70681661) has the molecular formula C15H9ClF3NO2
and a molecular weight of 327.69 g/mol. Its IUPAC name is (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide |
| PubChem CID | 70681661 |
| Molecular Formula | C15H9ClF3NO2 |
| Molecular Weight | 327.69 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(F)c(F)c(F)c2)cc1Cl)NO |
| InChI | InChI=1S/C15H9ClF3NO2/c16-11-5-9(2-1-8(11)3-4-14(21)20-22)10-6-12(17)15(19)13(18)7-10/h1-7,22H,(H,20,21)/b4-3+ |
| InChIKey | YVJZLDIILSSZKD-ONEGZZNKSA-N |
| XLogP | 3.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide?
The IUPAC name of (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide (CID 70681661) is (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide.
What is the SMILES notation for (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide?
The canonical SMILES for (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide is O=C(/C=C/c1ccc(-c2cc(F)c(F)c(F)c2)cc1Cl)NO.
What is the InChIKey of (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide?
The InChIKey is YVJZLDIILSSZKD-ONEGZZNKSA-N. The full InChI is InChI=1S/C15H9ClF3NO2/c16-11-5-9(2-1-8(11)3-4-14(21)20-22)10-6-12(17)15(19)13(18)7-10/h1-7,22H,(H,20,21)/b4-3+.
What are the key properties of (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide?
(E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide has a molecular weight of 327.69 g/mol, XLogP of 3.94, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2-chloro-4-(3,4,5-trifluorophenyl)phenyl]-N-hydroxyprop-2-enamide is sourced from PubChem (CID 70681661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).