C18H37F2NO2 — CID 70681745
(2S,3S,5S)-2-amino-11,11-difluorooctadecane-3,5-diol (PubChem CID 70681745) has the molecular formula C18H37F2NO2 and a molecular weight of 337.50 g/mol. Its IUPAC name is (2S,3S,5S)-2-amino-11,11-difluorooctadecane-3,5-diol.
| Compound Name | (2S,3S,5S)-2-amino-11,11-difluorooctadecane-3,5-diol |
|---|---|
| PubChem CID | 70681745 |
| Molecular Formula | C18H37F2NO2 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | (2S,3S,5S)-2-amino-11,11-difluorooctadecane-3,5-diol |
| SMILES | CCCCCCCC(F)(F)CCCCC[C@H](O)C[C@H](O)[C@H](C)N |
| InChI | InChI=1S/C18H37F2NO2/c1-3-4-5-6-9-12-18(19,20)13-10-7-8-11-16(22)14-17(23)15(2)21/h15-17,22-23H,3-14,21H2,1-2H3/t15-,16-,17-/m0/s1 |
| InChIKey | RDYODIXCKUHTSH-ULQDDVLXSA-N |
| XLogP | 4.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|