C14H9FN2O4 — CID 70681781
5-[(4-fluorophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 70681781) has the molecular formula C14H9FN2O4 and a molecular weight of 288.23 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-[(4-fluorophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 70681781 |
| Molecular Formula | C14H9FN2O4 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | O=c1[nH]c(=O)c2c(Cc3ccc(F)cc3)cc(=O)oc2[nH]1 |
| InChI | InChI=1S/C14H9FN2O4/c15-9-3-1-7(2-4-9)5-8-6-10(18)21-13-11(8)12(19)16-14(20)17-13/h1-4,6H,5H2,(H2,16,17,19,20) |
| InChIKey | JFXXMWZQPCVBSK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |