About 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide
2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 70681808) has the molecular formula C22H21N3O3S
and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 70681808 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)c1csc(-c2ccc3c(c2)CCO3)n1 |
| InChI | InChI=1S/C22H21N3O3S/c26-21(23-17-3-1-2-4-19(17)25-8-11-27-12-9-25)18-14-29-22(24-18)16-5-6-20-15(13-16)7-10-28-20/h1-6,13-14H,7-12H2,(H,23,26) |
| InChIKey | DRTUFTYYMVYVAS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide (CID 70681808) is 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide is O=C(Nc1ccccc1N1CCOCC1)c1csc(-c2ccc3c(c2)CCO3)n1.
What is the InChIKey of 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide?
The InChIKey is DRTUFTYYMVYVAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O3S/c26-21(23-17-3-1-2-4-19(17)25-8-11-27-12-9-25)18-14-29-22(24-18)16-5-6-20-15(13-16)7-10-28-20/h1-6,13-14H,7-12H2,(H,23,26).
What are the key properties of 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide?
2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide has a molecular weight of 407.50 g/mol, XLogP of 3.83, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1-benzofuran-5-yl)-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 70681808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).