C20H34 — CID 70681871
(1R,4R,9R,10R,12S,13S)-5,5,9,13-tetramethyltetracyclo[10.2.2.01,10.04,9]hexadecane (PubChem CID 70681871) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is (1R,4R,9R,10R,12S,13S)-5,5,9,13-tetramethyltetracyclo[10.2.2.01,10.04,9]hexadecane.
| Compound Name | (1R,4R,9R,10R,12S,13S)-5,5,9,13-tetramethyltetracyclo[10.2.2.01,10.04,9]hexadecane |
|---|---|
| PubChem CID | 70681871 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | (1R,4R,9R,10R,12S,13S)-5,5,9,13-tetramethyltetracyclo[10.2.2.01,10.04,9]hexadecane |
| SMILES | C[C@H]1C[C@]23CC[C@H]1C[C@H]2[C@]1(C)CCCC(C)(C)[C@H]1CC3 |
| InChI | InChI=1S/C20H34/c1-14-13-20-10-6-15(14)12-17(20)19(4)9-5-8-18(2,3)16(19)7-11-20/h14-17H,5-13H2,1-4H3/t14-,15-,16+,17-,19+,20+/m0/s1 |
| InChIKey | UCOPQLQDVYQSTF-QTGPRJIVSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |