C10H12N4O — CID 70682271
4-(benzylamino)-2,5-dihydro-1H-1,3,5-triazin-6-one (PubChem CID 70682271) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-(benzylamino)-2,5-dihydro-1H-1,3,5-triazin-6-one.
| Compound Name | 4-(benzylamino)-2,5-dihydro-1H-1,3,5-triazin-6-one |
|---|---|
| PubChem CID | 70682271 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-(benzylamino)-2,5-dihydro-1H-1,3,5-triazin-6-one |
| SMILES | O=C1NCN=C(NCc2ccccc2)N1 |
| InChI | InChI=1S/C10H12N4O/c15-10-13-7-12-9(14-10)11-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H3,11,12,13,14,15) |
| InChIKey | ROFNQSYHISDRLZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |