C22H32O5 — CID 70682371
methyl (4E,6S,8E,10E,12E,14E,16E,18R,19S)-6,18,20-trihydroxy-19-methylicosa-4,8,10,12,14,16-hexaenoate (PubChem CID 70682371) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is methyl (4E,6S,8E,10E,12E,14E,16E,18R,19S)-6,18,20-trihydroxy-19-methylicosa-4,8,10,12,14,16-hexaenoate.
| Compound Name | methyl (4E,6S,8E,10E,12E,14E,16E,18R,19S)-6,18,20-trihydroxy-19-methylicosa-4,8,10,12,14,16-hexaenoate |
|---|---|
| PubChem CID | 70682371 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl (4E,6S,8E,10E,12E,14E,16E,18R,19S)-6,18,20-trihydroxy-19-methylicosa-4,8,10,12,14,16-hexaenoate |
| SMILES | COC(=O)CC/C=C/[C@@H](O)C/C=C/C=C/C=C/C=C/C=C/[C@@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C22H32O5/c1-19(18-23)21(25)16-11-9-7-5-3-4-6-8-10-14-20(24)15-12-13-17-22(26)27-2/h3-12,15-16,19-21,23-25H,13-14,17-18H2,1-2H3/b5-3+,6-4+,9-7+,10-8+,15-12+,16-11+/t19-,20-,21+/m0/s1 |
| InChIKey | BIYNTKOCLUJCQH-YMPGKOBNSA-N |
| XLogP | 3.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|