C37H48N4O10 — CID 70682396
5-[[5-[2-(1-adamantyl)ethyl]-2-phenyl-1H-imidazole-4-carbonyl]amino]benzene-1,3-dicarboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 70682396) has the molecular formula C37H48N4O10 and a molecular weight of 708.81 g/mol. Its IUPAC name is 5-[[5-[2-(1-adamantyl)ethyl]-2-phenyl-1H-imidazole-4-carbonyl]amino]benzene-1,3-dicarboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 5-[[5-[2-(1-adamantyl)ethyl]-2-phenyl-1H-imidazole-4-carbonyl]amino]benzene-1,3-dicarboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 70682396 |
| Molecular Formula | C37H48N4O10 |
| Molecular Weight | 708.81 g/mol |
| Exact Mass | 708.34 |
| IUPAC Name | 5-[[5-[2-(1-adamantyl)ethyl]-2-phenyl-1H-imidazole-4-carbonyl]amino]benzene-1,3-dicarboxylic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)c1cc(NC(=O)c2nc(-c3ccccc3)[nH]c2CCC23CC4CC(CC(C4)C2)C3)cc(C(=O)O)c1 |
| InChI | InChI=1S/C30H31N3O5.C7H17NO5/c34-27(31-23-12-21(28(35)36)11-22(13-23)29(37)38)25-24(32-26(33-25)20-4-2-1-3-5-20)6-7-30-14-17-8-18(15-30)10-19(9-17)16-30;1-8-2-4(10)6(12)7(13)5(11)3-9/h1-5,11-13,17-19H,6-10,14-16H2,(H,31,34)(H,32,33)(H,35,36)(H,37,38);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | LSIKXGBFSKIYBP-WZTVWXICSA-N |
| XLogP | 2.52 |
| TPSA | 245.56 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.81 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |