C20H21F3N4O2 — CID 70682494
(3R)-3-amino-1-[4-(pyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 70682494) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-(pyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[4-(pyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 70682494 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (3R)-3-amino-1-[4-(pyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)c2ccccn2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H21F3N4O2/c21-15-12-17(23)16(22)10-13(15)9-14(24)11-19(28)26-5-7-27(8-6-26)20(29)18-3-1-2-4-25-18/h1-4,10,12,14H,5-9,11,24H2/t14-/m1/s1 |
| InChIKey | IKIBXUIGRIGPHW-CQSZACIVSA-N |
| XLogP | 1.74 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|