C20H19F5N4O2 — CID 70682495
(3R)-3-amino-1-[4-(3,5-difluoropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 70682495) has the molecular formula C20H19F5N4O2 and a molecular weight of 442.39 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-(3,5-difluoropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[4-(3,5-difluoropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 70682495 |
| Molecular Formula | C20H19F5N4O2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (3R)-3-amino-1-[4-(3,5-difluoropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)c2ncc(F)cc2F)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H19F5N4O2/c21-12-7-17(25)19(27-10-12)20(31)29-3-1-28(2-4-29)18(30)8-13(26)5-11-6-15(23)16(24)9-14(11)22/h6-7,9-10,13H,1-5,8,26H2/t13-/m1/s1 |
| InChIKey | WYWZPDHSEZKBIB-CYBMUJFWSA-N |
| XLogP | 2.02 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|