C40H46N4O4 — CID 70682499
2-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]-5-[3-[2-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]-1,3-oxazol-5-yl]phenyl]-1,3-oxazole (PubChem CID 70682499) has the molecular formula C40H46N4O4 and a molecular weight of 646.83 g/mol. Its IUPAC name is 2-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]-5-[3-[2-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]-1,3-oxazol-5-yl]phenyl]-1,3-oxazole.
| Compound Name | 2-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]-5-[3-[2-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]-1,3-oxazol-5-yl]phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 70682499 |
| Molecular Formula | C40H46N4O4 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | 2-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]-5-[3-[2-[4-(4-pyrrolidin-1-ylbutoxy)phenyl]-1,3-oxazol-5-yl]phenyl]-1,3-oxazole |
| SMILES | c1cc(-c2cnc(-c3ccc(OCCCCN4CCCC4)cc3)o2)cc(-c2cnc(-c3ccc(OCCCCN4CCCC4)cc3)o2)c1 |
| InChI | InChI=1S/C40H46N4O4/c1-2-21-43(20-1)24-5-7-26-45-35-16-12-31(13-17-35)39-41-29-37(47-39)33-10-9-11-34(28-33)38-30-42-40(48-38)32-14-18-36(19-15-32)46-27-8-6-25-44-22-3-4-23-44/h9-19,28-30H,1-8,20-27H2 |
| InChIKey | XCKVWTRXTMZSSD-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 77.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|