C20H15NO7S — CID 70682553
10-O-ethyl 2-O-methyl 8-methoxy-4,11-dioxo-[1]benzothiolo[6,5-b]indolizine-2,10-dicarboxylate (PubChem CID 70682553) has the molecular formula C20H15NO7S and a molecular weight of 413.41 g/mol. Its IUPAC name is 10-O-ethyl 2-O-methyl 8-methoxy-4,11-dioxo-[1]benzothiolo[6,5-b]indolizine-2,10-dicarboxylate.
| Compound Name | 10-O-ethyl 2-O-methyl 8-methoxy-4,11-dioxo-[1]benzothiolo[6,5-b]indolizine-2,10-dicarboxylate |
|---|---|
| PubChem CID | 70682553 |
| Molecular Formula | C20H15NO7S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 10-O-ethyl 2-O-methyl 8-methoxy-4,11-dioxo-[1]benzothiolo[6,5-b]indolizine-2,10-dicarboxylate |
| SMILES | CCOC(=O)c1c2c(n3ccc(OC)cc13)C(=O)c1cc(C(=O)OC)sc1C2=O |
| InChI | InChI=1S/C20H15NO7S/c1-4-28-20(25)13-11-7-9(26-2)5-6-21(11)15-14(13)17(23)18-10(16(15)22)8-12(29-18)19(24)27-3/h5-8H,4H2,1-3H3 |
| InChIKey | NCDVESKKGMTJDJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|