About 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine
1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine (PubChem CID 70682683) has the molecular formula C22H23NO
and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine |
| PubChem CID | 70682683 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C22H23NO/c1-23(2)22(18-10-6-4-7-11-18,19-12-8-5-9-13-19)20-14-16-21(24-3)17-15-20/h4-17H,1-3H3 |
| InChIKey | GBSKVROJXNNMFE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine?
The IUPAC name of 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine (CID 70682683) is 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine.
What is the SMILES notation for 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine?
The canonical SMILES for 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine is COc1ccc(C(c2ccccc2)(c2ccccc2)N(C)C)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine?
The InChIKey is GBSKVROJXNNMFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO/c1-23(2)22(18-10-6-4-7-11-18,19-12-8-5-9-13-19)20-14-16-21(24-3)17-15-20/h4-17H,1-3H3.
What are the key properties of 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine?
1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine has a molecular weight of 317.43 g/mol, XLogP of 4.55, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-N,N-dimethyl-1,1-diphenylmethanamine is sourced from PubChem (CID 70682683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).