C30H20O2S4 — CID 70682758
2,3,5,6-tetrakis(phenylsulfanyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 70682758) has the molecular formula C30H20O2S4 and a molecular weight of 540.76 g/mol. Its IUPAC name is 2,3,5,6-tetrakis(phenylsulfanyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5,6-tetrakis(phenylsulfanyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 70682758 |
| Molecular Formula | C30H20O2S4 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | 2,3,5,6-tetrakis(phenylsulfanyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(Sc2ccccc2)=C(Sc2ccccc2)C(=O)C(Sc2ccccc2)=C1Sc1ccccc1 |
| InChI | InChI=1S/C30H20O2S4/c31-25-27(33-21-13-5-1-6-14-21)28(34-22-15-7-2-8-16-22)26(32)30(36-24-19-11-4-12-20-24)29(25)35-23-17-9-3-10-18-23/h1-20H |
| InChIKey | CKBKZOGXBHNFFU-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|