C23H26BrN3O3 — CID 70682808
2-[1-(4-bromobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 70682808) has the molecular formula C23H26BrN3O3 and a molecular weight of 472.38 g/mol. Its IUPAC name is 2-[1-(4-bromobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-[2-(dimethylamino)ethyl]acetamide.
| Compound Name | 2-[1-(4-bromobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-[2-(dimethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 70682808 |
| Molecular Formula | C23H26BrN3O3 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 2-[1-(4-bromobenzoyl)-5-methoxy-2-methylindol-3-yl]-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCCN(C)C)c(C)n2C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H26BrN3O3/c1-15-19(14-22(28)25-11-12-26(2)3)20-13-18(30-4)9-10-21(20)27(15)23(29)16-5-7-17(24)8-6-16/h5-10,13H,11-12,14H2,1-4H3,(H,25,28) |
| InChIKey | VXDZDBJAZAHBLQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |