About 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine
1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine (PubChem CID 70682809) has the molecular formula C24H15F2NO
and a molecular weight of 371.39 g/mol. Its IUPAC name is 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine.
Molecular Properties
| Compound Name | 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine |
| PubChem CID | 70682809 |
| Molecular Formula | C24H15F2NO |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine |
| SMILES | Fc1ccc(C2=NC(c3ccc(F)cc3)c3c(ccc4ccccc34)O2)cc1 |
| InChI | InChI=1S/C24H15F2NO/c25-18-10-5-16(6-11-18)23-22-20-4-2-1-3-15(20)9-14-21(22)28-24(27-23)17-7-12-19(26)13-8-17/h1-14,23H |
| InChIKey | IAUWNPVVNLBOSO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine?
The IUPAC name of 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine (CID 70682809) is 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine.
What is the SMILES notation for 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine?
The canonical SMILES for 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine is Fc1ccc(C2=NC(c3ccc(F)cc3)c3c(ccc4ccccc34)O2)cc1.
What is the InChIKey of 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine?
The InChIKey is IAUWNPVVNLBOSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15F2NO/c25-18-10-5-16(6-11-18)23-22-20-4-2-1-3-15(20)9-14-21(22)28-24(27-23)17-7-12-19(26)13-8-17/h1-14,23H.
What are the key properties of 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine?
1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine has a molecular weight of 371.39 g/mol, XLogP of 6.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(4-fluorophenyl)-1H-benzo[f][1,3]benzoxazine is sourced from PubChem (CID 70682809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).