About [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate
[(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate (PubChem CID 70682814) has the molecular formula C23H19N3O2
and a molecular weight of 369.42 g/mol. Its IUPAC name is [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate.
Molecular Properties
| Compound Name | [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate |
| PubChem CID | 70682814 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O/N=C(\Cn2ccnc2)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H19N3O2/c1-17-6-8-19(9-7-17)23(27)28-25-22(15-26-13-12-24-16-26)21-11-10-18-4-2-3-5-20(18)14-21/h2-14,16H,15H2,1H3/b25-22+ |
| InChIKey | NBDJXRAUKSAUQZ-YYDJUVGSSA-N |
| XLogP | 4.61 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate?
The IUPAC name of [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate (CID 70682814) is [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate.
What is the SMILES notation for [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate?
The canonical SMILES for [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate is Cc1ccc(C(=O)O/N=C(\Cn2ccnc2)c2ccc3ccccc3c2)cc1.
What is the InChIKey of [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate?
The InChIKey is NBDJXRAUKSAUQZ-YYDJUVGSSA-N. The full InChI is InChI=1S/C23H19N3O2/c1-17-6-8-19(9-7-17)23(27)28-25-22(15-26-13-12-24-16-26)21-11-10-18-4-2-3-5-20(18)14-21/h2-14,16H,15H2,1H3/b25-22+.
What are the key properties of [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate?
[(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate has a molecular weight of 369.42 g/mol, XLogP of 4.61, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-methylbenzoate is sourced from PubChem (CID 70682814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).