About [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride
[(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride (PubChem CID 70682816) has the molecular formula C28H22ClN3O2
and a molecular weight of 467.96 g/mol. Its IUPAC name is [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride.
Molecular Properties
| Compound Name | [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride |
| PubChem CID | 70682816 |
| Molecular Formula | C28H22ClN3O2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride |
| SMILES | Cl.O=C(O/N=C(\Cn1ccnc1)c1ccc2ccccc2c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H21N3O2.ClH/c32-28(24-13-10-23(11-14-24)21-6-2-1-3-7-21)33-30-27(19-31-17-16-29-20-31)26-15-12-22-8-4-5-9-25(22)18-26;/h1-18,20H,19H2;1H/b30-27+; |
| InChIKey | KNHANTXJLWTJJN-CXTQECRMSA-N |
| XLogP | 6.39 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride?
The IUPAC name of [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride (CID 70682816) is [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride.
What is the SMILES notation for [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride?
The canonical SMILES for [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride is Cl.O=C(O/N=C(\Cn1ccnc1)c1ccc2ccccc2c1)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride?
The InChIKey is KNHANTXJLWTJJN-CXTQECRMSA-N. The full InChI is InChI=1S/C28H21N3O2.ClH/c32-28(24-13-10-23(11-14-24)21-6-2-1-3-7-21)33-30-27(19-31-17-16-29-20-31)26-15-12-22-8-4-5-9-25(22)18-26;/h1-18,20H,19H2;1H/b30-27+;.
What are the key properties of [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride?
[(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride has a molecular weight of 467.96 g/mol, XLogP of 6.39, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(2-imidazol-1-yl-1-naphthalen-2-ylethylidene)amino] 4-phenylbenzoate;hydrochloride is sourced from PubChem (CID 70682816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).