About (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride
(5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride (PubChem CID 70682918) has the molecular formula C23H25ClN2O2
and a molecular weight of 396.92 g/mol. Its IUPAC name is (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride.
Molecular Properties
| Compound Name | (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride |
| PubChem CID | 70682918 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride |
| SMILES | CCCc1nccn1C[C@H]1CC(c2ccccc2)(c2ccccc2)C(=O)O1.Cl |
| InChI | InChI=1S/C23H24N2O2.ClH/c1-2-9-21-24-14-15-25(21)17-20-16-23(22(26)27-20,18-10-5-3-6-11-18)19-12-7-4-8-13-19;/h3-8,10-15,20H,2,9,16-17H2,1H3;1H/t20-;/m1./s1 |
| InChIKey | AQURUXQWWLFPRV-VEIFNGETSA-N |
| XLogP | 4.56 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride?
The IUPAC name of (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride (CID 70682918) is (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride.
What is the SMILES notation for (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride?
The canonical SMILES for (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride is CCCc1nccn1C[C@H]1CC(c2ccccc2)(c2ccccc2)C(=O)O1.Cl.
What is the InChIKey of (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride?
The InChIKey is AQURUXQWWLFPRV-VEIFNGETSA-N. The full InChI is InChI=1S/C23H24N2O2.ClH/c1-2-9-21-24-14-15-25(21)17-20-16-23(22(26)27-20,18-10-5-3-6-11-18)19-12-7-4-8-13-19;/h3-8,10-15,20H,2,9,16-17H2,1H3;1H/t20-;/m1./s1.
What are the key properties of (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride?
(5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride has a molecular weight of 396.92 g/mol, XLogP of 4.56, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3,3-diphenyl-5-[(2-propylimidazol-1-yl)methyl]oxolan-2-one;hydrochloride is sourced from PubChem (CID 70682918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).