C26H36F2N2O2 — CID 70683216
(2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[[(1R)-1-(4-fluorophenyl)-3-methylbutyl]amino]-N-hydroxyhexanamide (PubChem CID 70683216) has the molecular formula C26H36F2N2O2 and a molecular weight of 446.58 g/mol. Its IUPAC name is (2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[[(1R)-1-(4-fluorophenyl)-3-methylbutyl]amino]-N-hydroxyhexanamide.
| Compound Name | (2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[[(1R)-1-(4-fluorophenyl)-3-methylbutyl]amino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 70683216 |
| Molecular Formula | C26H36F2N2O2 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[[(1R)-1-(4-fluorophenyl)-3-methylbutyl]amino]-N-hydroxyhexanamide |
| SMILES | Cc1cc(C[C@H](CCCCN[C@H](CC(C)C)c2ccc(F)cc2)C(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C26H36F2N2O2/c1-17(2)13-24(21-8-10-23(27)11-9-21)29-12-6-5-7-22(26(31)30-32)16-20-14-18(3)25(28)19(4)15-20/h8-11,14-15,17,22,24,29,32H,5-7,12-13,16H2,1-4H3,(H,30,31)/t22-,24+/m0/s1 |
| InChIKey | IEAXISQFLAARMR-LADGPHEKSA-N |
| XLogP | 5.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|