C14H10FN3O3S2 — CID 70683254
1-(4-fluorophenyl)-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)thiourea (PubChem CID 70683254) has the molecular formula C14H10FN3O3S2 and a molecular weight of 351.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)thiourea |
|---|---|
| PubChem CID | 70683254 |
| Molecular Formula | C14H10FN3O3S2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)thiourea |
| SMILES | O=C1NS(=O)(=O)c2cc(NC(=S)Nc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C14H10FN3O3S2/c15-8-1-3-9(4-2-8)16-14(22)17-10-5-6-11-12(7-10)23(20,21)18-13(11)19/h1-7H,(H,18,19)(H2,16,17,22) |
| InChIKey | JEUOVOYTBAUKNR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|