C26H21BrN2O3 — CID 70683381
2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone bromide (PubChem CID 70683381) has the molecular formula C26H21BrN2O3 and a molecular weight of 489.37 g/mol. Its IUPAC name is 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone bromide.
| Compound Name | 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone bromide |
|---|---|
| PubChem CID | 70683381 |
| Molecular Formula | C26H21BrN2O3 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone bromide |
| SMILES | COc1ccc(C(=O)C[n+]2ccn(-c3ccc(-c4cc5ccccc5o4)cc3)c2)cc1.[Br-] |
| InChI | InChI=1S/C26H21N2O3.BrH/c1-30-23-12-8-19(9-13-23)24(29)17-27-14-15-28(18-27)22-10-6-20(7-11-22)26-16-21-4-2-3-5-25(21)31-26;/h2-16,18H,17H2,1H3;1H/q+1;/p-1 |
| InChIKey | DYXPLSYIKSRVFF-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 48.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|