About N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine
N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine (PubChem CID 70683494) has the molecular formula C19H16ClN5O2
and a molecular weight of 381.82 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine |
| PubChem CID | 70683494 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine |
| SMILES | COc1ccc(-c2nc(Nc3cccc(Cl)c3)nc3nc[nH]c23)cc1OC |
| InChI | InChI=1S/C19H16ClN5O2/c1-26-14-7-6-11(8-15(14)27-2)16-17-18(22-10-21-17)25-19(24-16)23-13-5-3-4-12(20)9-13/h3-10H,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | NXPRGHRSTVWAIH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine?
The IUPAC name of N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine (CID 70683494) is N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine.
What is the SMILES notation for N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine?
The canonical SMILES for N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine is COc1ccc(-c2nc(Nc3cccc(Cl)c3)nc3nc[nH]c23)cc1OC.
What is the InChIKey of N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine?
The InChIKey is NXPRGHRSTVWAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClN5O2/c1-26-14-7-6-11(8-15(14)27-2)16-17-18(22-10-21-17)25-19(24-16)23-13-5-3-4-12(20)9-13/h3-10H,1-2H3,(H2,21,22,23,24,25).
What are the key properties of N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine?
N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine has a molecular weight of 381.82 g/mol, XLogP of 4.43, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-6-(3,4-dimethoxyphenyl)-7H-purin-2-amine is sourced from PubChem (CID 70683494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).