C20H29N3O4 — CID 70683569
ethyl (1R,5S)-3-[2-[(3-methoxybenzoyl)amino]ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 70683569) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl (1R,5S)-3-[2-[(3-methoxybenzoyl)amino]ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | ethyl (1R,5S)-3-[2-[(3-methoxybenzoyl)amino]ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 70683569 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | ethyl (1R,5S)-3-[2-[(3-methoxybenzoyl)amino]ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCOC(=O)N1[C@@H]2CC[C@H]1CC(NCCNC(=O)c1cccc(OC)c1)C2 |
| InChI | InChI=1S/C20H29N3O4/c1-3-27-20(25)23-16-7-8-17(23)13-15(12-16)21-9-10-22-19(24)14-5-4-6-18(11-14)26-2/h4-6,11,15-17,21H,3,7-10,12-13H2,1-2H3,(H,22,24)/t15?,16-,17+ |
| InChIKey | BGDCDNMUAYHSIA-ALOPSCKCSA-N |
| XLogP | 2.17 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|