C22H28N2O5 — CID 70684075
(1R,3'S,9S,11S,18S)-8-acetyl-6-hydroxy-5-methoxy-3',14-dimethylspiro[8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2(7),3,5-triene-18,2'-oxirane]-17-one (PubChem CID 70684075) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is (1R,3'S,9S,11S,18S)-8-acetyl-6-hydroxy-5-methoxy-3',14-dimethylspiro[8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2(7),3,5-triene-18,2'-oxirane]-17-one.
| Compound Name | (1R,3'S,9S,11S,18S)-8-acetyl-6-hydroxy-5-methoxy-3',14-dimethylspiro[8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2(7),3,5-triene-18,2'-oxirane]-17-one |
|---|---|
| PubChem CID | 70684075 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (1R,3'S,9S,11S,18S)-8-acetyl-6-hydroxy-5-methoxy-3',14-dimethylspiro[8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2(7),3,5-triene-18,2'-oxirane]-17-one |
| SMILES | COc1ccc2c(c1O)N(C(C)=O)[C@H]1C[C@@H]3CCN(C)CC[C@@]21C(=O)[C@]31O[C@H]1C |
| InChI | InChI=1S/C22H28N2O5/c1-12-22(29-12)14-7-9-23(3)10-8-21(20(22)27)15-5-6-16(28-4)19(26)18(15)24(13(2)25)17(21)11-14/h5-6,12,14,17,26H,7-11H2,1-4H3/t12-,14-,17-,21+,22+/m0/s1 |
| InChIKey | PCKNNBQTKQWZDD-JIYRDRQMSA-N |
| XLogP | 1.85 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|