C21H24N2O4 — CID 70684077
1-[(1R,3S,11R,15S)-6-hydroxy-8-methoxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]ethanone (PubChem CID 70684077) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-[(1R,3S,11R,15S)-6-hydroxy-8-methoxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]ethanone.
| Compound Name | 1-[(1R,3S,11R,15S)-6-hydroxy-8-methoxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]ethanone |
|---|---|
| PubChem CID | 70684077 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-[(1R,3S,11R,15S)-6-hydroxy-8-methoxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]ethanone |
| SMILES | COc1cc(O)c2c(c1)[C@]13CCN4CC[C@H](C[C@@H]1N2C(C)=O)C1=CCO[C@]143 |
| InChI | InChI=1S/C21H24N2O4/c1-12(24)23-18-9-13-3-6-22-7-5-20(18,21(22)15(13)4-8-27-21)16-10-14(26-2)11-17(25)19(16)23/h4,10-11,13,18,25H,3,5-9H2,1-2H3/t13-,18+,20-,21+/m1/s1 |
| InChIKey | XORSOONLULVOCT-WTXAKBKRSA-N |
| XLogP | 2.16 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|