C10H10ClNO3 — CID 70684131
2-chloro-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium-4-carboxylic acid (PubChem CID 70684131) has the molecular formula C10H10ClNO3 and a molecular weight of 227.65 g/mol. Its IUPAC name is 2-chloro-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium-4-carboxylic acid.
| Compound Name | 2-chloro-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 70684131 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2-chloro-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)[n+]([O-])c2c1CCCC2 |
| InChI | InChI=1S/C10H10ClNO3/c11-9-5-7(10(13)14)6-3-1-2-4-8(6)12(9)15/h5H,1-4H2,(H,13,14) |
| InChIKey | PTAGJVOXCYAVDZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|