About 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine
2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine (PubChem CID 70684228) has the molecular formula C26H21ClN4
and a molecular weight of 424.94 g/mol. Its IUPAC name is 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine.
Molecular Properties
| Compound Name | 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine |
| PubChem CID | 70684228 |
| Molecular Formula | C26H21ClN4 |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine |
| SMILES | Cn1c2ccccc2c2c(NCCc3c[nH]c4ccccc34)c3cc(Cl)ccc3nc21 |
| InChI | InChI=1S/C26H21ClN4/c1-31-23-9-5-3-7-19(23)24-25(20-14-17(27)10-11-22(20)30-26(24)31)28-13-12-16-15-29-21-8-4-2-6-18(16)21/h2-11,14-15,29H,12-13H2,1H3,(H,28,30) |
| InChIKey | GRNINQJFXJOVEL-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine?
The IUPAC name of 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine (CID 70684228) is 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine.
What is the SMILES notation for 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine?
The canonical SMILES for 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine is Cn1c2ccccc2c2c(NCCc3c[nH]c4ccccc34)c3cc(Cl)ccc3nc21.
What is the InChIKey of 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine?
The InChIKey is GRNINQJFXJOVEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21ClN4/c1-31-23-9-5-3-7-19(23)24-25(20-14-17(27)10-11-22(20)30-26(24)31)28-13-12-16-15-29-21-8-4-2-6-18(16)21/h2-11,14-15,29H,12-13H2,1H3,(H,28,30).
What are the key properties of 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine?
2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine has a molecular weight of 424.94 g/mol, XLogP of 6.67, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[2-(1H-indol-3-yl)ethyl]-6-methylindolo[2,3-b]quinolin-11-amine is sourced from PubChem (CID 70684228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).