About [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea
[(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (PubChem CID 70684341) has the molecular formula C10H11N3OS2
and a molecular weight of 253.35 g/mol. Its IUPAC name is [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| PubChem CID | 70684341 |
| Molecular Formula | C10H11N3OS2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| SMILES | NC(=S)N/N=C1\CCSc2ccc(O)cc21 |
| InChI | InChI=1S/C10H11N3OS2/c11-10(15)13-12-8-3-4-16-9-2-1-6(14)5-7(8)9/h1-2,5,14H,3-4H2,(H3,11,13,15)/b12-8+ |
| InChIKey | NVZXEUPHLYJKNF-XYOKQWHBSA-N |
| XLogP | 1.43 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The IUPAC name of [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (CID 70684341) is [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
What is the SMILES notation for [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The canonical SMILES for [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea is NC(=S)N/N=C1\CCSc2ccc(O)cc21.
What is the InChIKey of [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The InChIKey is NVZXEUPHLYJKNF-XYOKQWHBSA-N. The full InChI is InChI=1S/C10H11N3OS2/c11-10(15)13-12-8-3-4-16-9-2-1-6(14)5-7(8)9/h1-2,5,14H,3-4H2,(H3,11,13,15)/b12-8+.
What are the key properties of [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
[(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea has a molecular weight of 253.35 g/mol, XLogP of 1.43, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(6-hydroxy-2,3-dihydrothiochromen-4-ylidene)amino]thiourea is sourced from PubChem (CID 70684341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).