C26H29N5O2S — CID 70684550
(3R)-1-(1-methylsulfonylpiperidin-4-yl)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 70684550) has the molecular formula C26H29N5O2S and a molecular weight of 475.62 g/mol. Its IUPAC name is (3R)-1-(1-methylsulfonylpiperidin-4-yl)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (3R)-1-(1-methylsulfonylpiperidin-4-yl)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 70684550 |
| Molecular Formula | C26H29N5O2S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | (3R)-1-(1-methylsulfonylpiperidin-4-yl)-3-(5-phenyl-1H-imidazol-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CS(=O)(=O)N1CCC(C2N[C@@H](c3ncc(-c4ccccc4)[nH]3)Cc3c2[nH]c2ccccc32)CC1 |
| InChI | InChI=1S/C26H29N5O2S/c1-34(32,33)31-13-11-18(12-14-31)24-25-20(19-9-5-6-10-21(19)28-25)15-22(29-24)26-27-16-23(30-26)17-7-3-2-4-8-17/h2-10,16,18,22,24,28-29H,11-15H2,1H3,(H,27,30)/t22-,24?/m1/s1 |
| InChIKey | QCHZQEKTYADHMQ-LETIRJCYSA-N |
| XLogP | 4.16 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|