C20H20ClF3N4O2 — CID 70684571
(3R)-3-amino-1-[4-(4-chloropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 70684571) has the molecular formula C20H20ClF3N4O2 and a molecular weight of 440.85 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-(4-chloropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[4-(4-chloropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 70684571 |
| Molecular Formula | C20H20ClF3N4O2 |
| Molecular Weight | 440.85 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (3R)-3-amino-1-[4-(4-chloropyridine-2-carbonyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)c2cc(Cl)ccn2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H20ClF3N4O2/c21-13-1-2-26-18(9-13)20(30)28-5-3-27(4-6-28)19(29)10-14(25)7-12-8-16(23)17(24)11-15(12)22/h1-2,8-9,11,14H,3-7,10,25H2/t14-/m1/s1 |
| InChIKey | LYEAZYRBSQPWTL-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.85 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|