About N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide
N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 70684617) has the molecular formula C21H23N3O5S2
and a molecular weight of 461.57 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 70684617 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(-c2ncc(C(=O)NC34CC5CC(CC(C5)C3)C4)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23N3O5S2/c1-31(28,29)18-3-2-15(7-16(18)24(26)27)20-22-11-17(30-20)19(25)23-21-8-12-4-13(9-21)6-14(5-12)10-21/h2-3,7,11-14H,4-6,8-10H2,1H3,(H,23,25) |
| InChIKey | RJBHRIIEYCYSRK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide (CID 70684617) is N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide is CS(=O)(=O)c1ccc(-c2ncc(C(=O)NC34CC5CC(CC(C5)C3)C4)s2)cc1[N+](=O)[O-].
What is the InChIKey of N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide?
The InChIKey is RJBHRIIEYCYSRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O5S2/c1-31(28,29)18-3-2-15(7-16(18)24(26)27)20-22-11-17(30-20)19(25)23-21-8-12-4-13(9-21)6-14(5-12)10-21/h2-3,7,11-14H,4-6,8-10H2,1H3,(H,23,25).
What are the key properties of N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide?
N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide has a molecular weight of 461.57 g/mol, XLogP of 3.82, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 70684617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).