C30H40O5 — CID 70684689
(1S,7S,9S)-12-[[(3R,6S,8S,10S)-3-hydroxy-2,6,10-trimethyl-10-tricyclo[6.3.0.03,6]undec-1-enyl]methoxy]-5,5-dimethyl-10-oxo-11-oxatetracyclo[7.3.1.01,9.03,7]tridec-2-ene-2-carbaldehyde (PubChem CID 70684689) has the molecular formula C30H40O5 and a molecular weight of 480.65 g/mol. Its IUPAC name is (1S,7S,9S)-12-[[(3R,6S,8S,10S)-3-hydroxy-2,6,10-trimethyl-10-tricyclo[6.3.0.03,6]undec-1-enyl]methoxy]-5,5-dimethyl-10-oxo-11-oxatetracyclo[7.3.1.01,9.03,7]tridec-2-ene-2-carbaldehyde.
| Compound Name | (1S,7S,9S)-12-[[(3R,6S,8S,10S)-3-hydroxy-2,6,10-trimethyl-10-tricyclo[6.3.0.03,6]undec-1-enyl]methoxy]-5,5-dimethyl-10-oxo-11-oxatetracyclo[7.3.1.01,9.03,7]tridec-2-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 70684689 |
| Molecular Formula | C30H40O5 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (1S,7S,9S)-12-[[(3R,6S,8S,10S)-3-hydroxy-2,6,10-trimethyl-10-tricyclo[6.3.0.03,6]undec-1-enyl]methoxy]-5,5-dimethyl-10-oxo-11-oxatetracyclo[7.3.1.01,9.03,7]tridec-2-ene-2-carbaldehyde |
| SMILES | CC1=C2C[C@@](C)(COC3OC(=O)[C@]45C[C@@H]6CC(C)(C)CC6=C(C=O)[C@]34C5)C[C@H]2C[C@]2(C)CC[C@]12O |
| InChI | InChI=1S/C30H40O5/c1-17-20-13-26(4,9-19(20)10-27(5)6-7-30(17,27)33)16-34-24-29-15-28(29,23(32)35-24)11-18-8-25(2,3)12-21(18)22(29)14-31/h14,18-19,24,33H,6-13,15-16H2,1-5H3/t18-,19-,24?,26-,27-,28+,29+,30-/m0/s1 |
| InChIKey | JVSGWCCMXPFMRE-IEGCPEISSA-N |
| XLogP | 5.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|