C26H37NO2 — CID 70684787
N-[3-prop-2-enyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phenyl]acetamide (PubChem CID 70684787) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is N-[3-prop-2-enyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phenyl]acetamide.
| Compound Name | N-[3-prop-2-enyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 70684787 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | N-[3-prop-2-enyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phenyl]acetamide |
| SMILES | C=CCc1cc(NC(C)=O)ccc1OC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H37NO2/c1-7-10-24-19-25(27-23(6)28)15-16-26(24)29-18-17-22(5)14-9-13-21(4)12-8-11-20(2)3/h7,11,13,15-17,19H,1,8-10,12,14,18H2,2-6H3,(H,27,28)/b21-13+,22-17+ |
| InChIKey | IXYOQOMIUFMLJQ-BRAPJGFWSA-N |
| XLogP | 7.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|