C33H50O6 — CID 70684922
methyl (1R,2R,4aS,6aR,6aS,6bR,8aR,11R,12aR,14bS)-11-acetyloxy-1-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-2H-picene-4a-carboxylate (PubChem CID 70684922) has the molecular formula C33H50O6 and a molecular weight of 542.76 g/mol. Its IUPAC name is methyl (1R,2R,4aS,6aR,6aS,6bR,8aR,11R,12aR,14bS)-11-acetyloxy-1-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-2H-picene-4a-carboxylate.
| Compound Name | methyl (1R,2R,4aS,6aR,6aS,6bR,8aR,11R,12aR,14bS)-11-acetyloxy-1-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-2H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 70684922 |
| Molecular Formula | C33H50O6 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | methyl (1R,2R,4aS,6aR,6aS,6bR,8aR,11R,12aR,14bS)-11-acetyloxy-1-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-2H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@@H](C)[C@@](C)(O)[C@H]1C1=CC[C@@H]3[C@@]4(C)C[C@@H](OC(C)=O)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C33H50O6/c1-19-12-15-33(27(36)38-9)17-16-30(6)21(25(33)32(19,8)37)10-11-24-29(5)18-22(39-20(2)34)26(35)28(3,4)23(29)13-14-31(24,30)7/h10,19,22-25,37H,11-18H2,1-9H3/t19-,22-,23+,24-,25-,29+,30-,31-,32-,33+/m1/s1 |
| InChIKey | WUVTUOJKRIRGOJ-YAEYESHMSA-N |
| XLogP | 6.04 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|