C25H34ClN7 — CID 70684941
N-(7-chloroquinolin-4-yl)-N'-[6-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]hexane-1,6-diamine (PubChem CID 70684941) has the molecular formula C25H34ClN7 and a molecular weight of 468.05 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-[6-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]hexane-1,6-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-[6-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 70684941 |
| Molecular Formula | C25H34ClN7 |
| Molecular Weight | 468.05 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-[6-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]hexane-1,6-diamine |
| SMILES | Cc1cc(NCCCCCCNc2ccnc3cc(Cl)ccc23)nc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C25H34ClN7/c1-19-17-24(31-25(30-19)33-15-13-32(2)14-16-33)29-11-6-4-3-5-10-27-22-9-12-28-23-18-20(26)7-8-21(22)23/h7-9,12,17-18H,3-6,10-11,13-16H2,1-2H3,(H,27,28)(H,29,30,31) |
| InChIKey | CRVUJSOSFHNJCD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.05 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|