About 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide
3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide (PubChem CID 70685217) has the molecular formula C25H29NO4
and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide.
Molecular Properties
| Compound Name | 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide |
| PubChem CID | 70685217 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc(O)cc2O)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H29NO4/c1-30-23-5-3-18(24(29)26-14-19-2-4-20(27)10-22(19)28)9-21(23)25-11-15-6-16(12-25)8-17(7-15)13-25/h2-5,9-10,15-17,27-28H,6-8,11-14H2,1H3,(H,26,29) |
| InChIKey | MZAJLDVRKVEVKU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide?
The IUPAC name of 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide (CID 70685217) is 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide.
What is the SMILES notation for 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide?
The canonical SMILES for 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide is COc1ccc(C(=O)NCc2ccc(O)cc2O)cc1C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide?
The InChIKey is MZAJLDVRKVEVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NO4/c1-30-23-5-3-18(24(29)26-14-19-2-4-20(27)10-22(19)28)9-21(23)25-11-15-6-16(12-25)8-17(7-15)13-25/h2-5,9-10,15-17,27-28H,6-8,11-14H2,1H3,(H,26,29).
What are the key properties of 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide?
3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide has a molecular weight of 407.51 g/mol, XLogP of 4.50, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-adamantyl)-N-[(2,4-dihydroxyphenyl)methyl]-4-methoxybenzamide is sourced from PubChem (CID 70685217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).