About 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid
4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid (PubChem CID 70685228) has the molecular formula C14H11BrN4O2
and a molecular weight of 347.17 g/mol. Its IUPAC name is 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid |
| PubChem CID | 70685228 |
| Molecular Formula | C14H11BrN4O2 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid |
| SMILES | CNc1c(Br)cnc2nc(-c3ccc(C(=O)O)cc3)[nH]c12 |
| InChI | InChI=1S/C14H11BrN4O2/c1-16-10-9(15)6-17-13-11(10)18-12(19-13)7-2-4-8(5-3-7)14(20)21/h2-6H,1H3,(H,20,21)(H2,16,17,18,19) |
| InChIKey | ZNBXHMDTLSAOFO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid?
The IUPAC name of 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid (CID 70685228) is 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid.
What is the SMILES notation for 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid?
The canonical SMILES for 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid is CNc1c(Br)cnc2nc(-c3ccc(C(=O)O)cc3)[nH]c12.
What is the InChIKey of 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid?
The InChIKey is ZNBXHMDTLSAOFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrN4O2/c1-16-10-9(15)6-17-13-11(10)18-12(19-13)7-2-4-8(5-3-7)14(20)21/h2-6H,1H3,(H,20,21)(H2,16,17,18,19).
What are the key properties of 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid?
4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid has a molecular weight of 347.17 g/mol, XLogP of 3.13, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-bromo-7-(methylamino)-1H-imidazo[4,5-b]pyridin-2-yl]benzoic acid is sourced from PubChem (CID 70685228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).