About 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine
6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine (PubChem CID 70685230) has the molecular formula C17H18BrN5O
and a molecular weight of 388.27 g/mol. Its IUPAC name is 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine.
Molecular Properties
| Compound Name | 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine |
| PubChem CID | 70685230 |
| Molecular Formula | C17H18BrN5O |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine |
| SMILES | CNc1c(Br)cnc2nc(-c3ccc(N4CCOCC4)cc3)[nH]c12 |
| InChI | InChI=1S/C17H18BrN5O/c1-19-14-13(18)10-20-17-15(14)21-16(22-17)11-2-4-12(5-3-11)23-6-8-24-9-7-23/h2-5,10H,6-9H2,1H3,(H2,19,20,21,22) |
| InChIKey | SCRGZHVPJJQKLF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine?
The IUPAC name of 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine (CID 70685230) is 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine.
What is the SMILES notation for 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine?
The canonical SMILES for 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine is CNc1c(Br)cnc2nc(-c3ccc(N4CCOCC4)cc3)[nH]c12.
What is the InChIKey of 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine?
The InChIKey is SCRGZHVPJJQKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrN5O/c1-19-14-13(18)10-20-17-15(14)21-16(22-17)11-2-4-12(5-3-11)23-6-8-24-9-7-23/h2-5,10H,6-9H2,1H3,(H2,19,20,21,22).
What are the key properties of 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine?
6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine has a molecular weight of 388.27 g/mol, XLogP of 3.27, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-methyl-2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine is sourced from PubChem (CID 70685230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).