About N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide
N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide (PubChem CID 70685615) has the molecular formula C25H27N7O3
and a molecular weight of 473.54 g/mol. Its IUPAC name is N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide |
| PubChem CID | 70685615 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(-c2nc(Nc3cccc(NC(=O)C4CCNCC4)c3)nc3nc[nH]c23)cc1OC |
| InChI | InChI=1S/C25H27N7O3/c1-34-19-7-6-16(12-20(19)35-2)21-22-23(28-14-27-22)32-25(31-21)30-18-5-3-4-17(13-18)29-24(33)15-8-10-26-11-9-15/h3-7,12-15,26H,8-11H2,1-2H3,(H,29,33)(H2,27,28,30,31,32) |
| InChIKey | KSGQCBIEDABXGB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 126.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide?
The IUPAC name of N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide (CID 70685615) is N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide.
What is the SMILES notation for N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide?
The canonical SMILES for N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide is COc1ccc(-c2nc(Nc3cccc(NC(=O)C4CCNCC4)c3)nc3nc[nH]c23)cc1OC.
What is the InChIKey of N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide?
The InChIKey is KSGQCBIEDABXGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N7O3/c1-34-19-7-6-16(12-20(19)35-2)21-22-23(28-14-27-22)32-25(31-21)30-18-5-3-4-17(13-18)29-24(33)15-8-10-26-11-9-15/h3-7,12-15,26H,8-11H2,1-2H3,(H,29,33)(H2,27,28,30,31,32).
What are the key properties of N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide?
N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide has a molecular weight of 473.54 g/mol, XLogP of 3.72, 7 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]piperidine-4-carboxamide is sourced from PubChem (CID 70685615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).