C29H36N4O6S — CID 70685620
N-(1,5-dimethylpyrazol-3-yl)-3-[4-(4-methoxypiperidin-1-yl)sulfonylphenoxy]-5-(3-methylbut-2-enoxy)benzamide (PubChem CID 70685620) has the molecular formula C29H36N4O6S and a molecular weight of 568.70 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-3-yl)-3-[4-(4-methoxypiperidin-1-yl)sulfonylphenoxy]-5-(3-methylbut-2-enoxy)benzamide.
| Compound Name | N-(1,5-dimethylpyrazol-3-yl)-3-[4-(4-methoxypiperidin-1-yl)sulfonylphenoxy]-5-(3-methylbut-2-enoxy)benzamide |
|---|---|
| PubChem CID | 70685620 |
| Molecular Formula | C29H36N4O6S |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | N-(1,5-dimethylpyrazol-3-yl)-3-[4-(4-methoxypiperidin-1-yl)sulfonylphenoxy]-5-(3-methylbut-2-enoxy)benzamide |
| SMILES | COC1CCN(S(=O)(=O)c2ccc(Oc3cc(OCC=C(C)C)cc(C(=O)Nc4cc(C)n(C)n4)c3)cc2)CC1 |
| InChI | InChI=1S/C29H36N4O6S/c1-20(2)12-15-38-25-17-22(29(34)30-28-16-21(3)32(4)31-28)18-26(19-25)39-24-6-8-27(9-7-24)40(35,36)33-13-10-23(37-5)11-14-33/h6-9,12,16-19,23H,10-11,13-15H2,1-5H3,(H,30,31,34) |
| InChIKey | SSKMAFJLOGCTSG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|