About 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene
1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene (PubChem CID 70685746) has the molecular formula C19H20O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene.
Molecular Properties
| Compound Name | 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene |
| PubChem CID | 70685746 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene |
| SMILES | C=CC(/C=C/c1ccc(OC)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C19H20O2/c1-4-16(17-6-5-7-19(14-17)21-3)11-8-15-9-12-18(20-2)13-10-15/h4-14,16H,1H2,2-3H3/b11-8+ |
| InChIKey | KPXCCISJUBCEPB-DHZHZOJOSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene?
The IUPAC name of 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene (CID 70685746) is 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene.
What is the SMILES notation for 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene?
The canonical SMILES for 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene is C=CC(/C=C/c1ccc(OC)cc1)c1cccc(OC)c1.
What is the InChIKey of 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene?
The InChIKey is KPXCCISJUBCEPB-DHZHZOJOSA-N. The full InChI is InChI=1S/C19H20O2/c1-4-16(17-6-5-7-19(14-17)21-3)11-8-15-9-12-18(20-2)13-10-15/h4-14,16H,1H2,2-3H3/b11-8+.
What are the key properties of 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene?
1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene has a molecular weight of 280.37 g/mol, XLogP of 4.69, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-[(1E)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]benzene is sourced from PubChem (CID 70685746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).