C39H40IN5O4S — CID 70685853
4-[2-(dibutylamino)pyrimidin-4-yl]-3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(7-iodonaphthalen-2-yl)sulfonylbenzamide (PubChem CID 70685853) has the molecular formula C39H40IN5O4S and a molecular weight of 801.75 g/mol. Its IUPAC name is 4-[2-(dibutylamino)pyrimidin-4-yl]-3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(7-iodonaphthalen-2-yl)sulfonylbenzamide.
| Compound Name | 4-[2-(dibutylamino)pyrimidin-4-yl]-3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(7-iodonaphthalen-2-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 70685853 |
| Molecular Formula | C39H40IN5O4S |
| Molecular Weight | 801.75 g/mol |
| Exact Mass | 801.18 |
| IUPAC Name | 4-[2-(dibutylamino)pyrimidin-4-yl]-3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(7-iodonaphthalen-2-yl)sulfonylbenzamide |
| SMILES | CCCCN(CCCC)c1nccc(-c2ccc(C(=O)NS(=O)(=O)c3ccc4ccc(I)cc4c3)cc2C(=O)N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C39H40IN5O4S/c1-3-5-20-44(21-6-4-2)39-41-19-17-36(42-39)34-16-13-29(25-35(34)38(47)45-22-18-27-9-7-8-10-30(27)26-45)37(46)43-50(48,49)33-15-12-28-11-14-32(40)23-31(28)24-33/h7-17,19,23-25H,3-6,18,20-22,26H2,1-2H3,(H,43,46) |
| InChIKey | RGBWJMXGRPCRTB-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.75 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|