C22H27FN2O — CID 70685860
(1R,2R,5E,9S,17S)-5-[(4-fluorophenyl)methylidene]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one (PubChem CID 70685860) has the molecular formula C22H27FN2O and a molecular weight of 354.47 g/mol. Its IUPAC name is (1R,2R,5E,9S,17S)-5-[(4-fluorophenyl)methylidene]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one.
| Compound Name | (1R,2R,5E,9S,17S)-5-[(4-fluorophenyl)methylidene]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
|---|---|
| PubChem CID | 70685860 |
| Molecular Formula | C22H27FN2O |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (1R,2R,5E,9S,17S)-5-[(4-fluorophenyl)methylidene]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| SMILES | O=C1/C(=C/c2ccc(F)cc2)CC[C@@H]2[C@H]3CCCN4CCC[C@@H](CN12)[C@@H]34 |
| InChI | InChI=1S/C22H27FN2O/c23-18-8-5-15(6-9-18)13-16-7-10-20-19-4-2-12-24-11-1-3-17(21(19)24)14-25(20)22(16)26/h5-6,8-9,13,17,19-21H,1-4,7,10-12,14H2/b16-13+/t17-,19+,20+,21-/m0/s1 |
| InChIKey | MGMNYYKFIGONDM-ORBNHADYSA-N |
| XLogP | 3.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|