About (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide
(E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide (PubChem CID 70685938) has the molecular formula C14H13ClN2O3
and a molecular weight of 292.72 g/mol. Its IUPAC name is (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide |
| PubChem CID | 70685938 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1noc(C)c1-c1ccc(/C=C/C(=O)NO)c(Cl)c1 |
| InChI | InChI=1S/C14H13ClN2O3/c1-8-14(9(2)20-17-8)11-4-3-10(12(15)7-11)5-6-13(18)16-19/h3-7,19H,1-2H3,(H,16,18)/b6-5+ |
| InChIKey | ISIYPXHNZZIKMU-AATRIKPKSA-N |
| XLogP | 3.13 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide?
The IUPAC name of (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide (CID 70685938) is (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide.
What is the SMILES notation for (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide?
The canonical SMILES for (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide is Cc1noc(C)c1-c1ccc(/C=C/C(=O)NO)c(Cl)c1.
What is the InChIKey of (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide?
The InChIKey is ISIYPXHNZZIKMU-AATRIKPKSA-N. The full InChI is InChI=1S/C14H13ClN2O3/c1-8-14(9(2)20-17-8)11-4-3-10(12(15)7-11)5-6-13(18)16-19/h3-7,19H,1-2H3,(H,16,18)/b6-5+.
What are the key properties of (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide?
(E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide has a molecular weight of 292.72 g/mol, XLogP of 3.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2-chloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-hydroxyprop-2-enamide is sourced from PubChem (CID 70685938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).