C21H25N3O2 — CID 70685981
(3S,4S)-3-N-benzyl-4-N-(2-phenylethyl)pyrrolidine-3,4-dicarboxamide (PubChem CID 70685981) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (3S,4S)-3-N-benzyl-4-N-(2-phenylethyl)pyrrolidine-3,4-dicarboxamide.
| Compound Name | (3S,4S)-3-N-benzyl-4-N-(2-phenylethyl)pyrrolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 70685981 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (3S,4S)-3-N-benzyl-4-N-(2-phenylethyl)pyrrolidine-3,4-dicarboxamide |
| SMILES | O=C(NCCc1ccccc1)[C@@H]1CNC[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c25-20(23-12-11-16-7-3-1-4-8-16)18-14-22-15-19(18)21(26)24-13-17-9-5-2-6-10-17/h1-10,18-19,22H,11-15H2,(H,23,25)(H,24,26)/t18-,19-/m1/s1 |
| InChIKey | FTHUUNUFKOJOCO-RTBURBONSA-N |
| XLogP | 1.50 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |