C27H27FN2O5 — CID 70686071
(3S,5S)-3,4-dibenzyl-5-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)piperazine-2,6-dione (PubChem CID 70686071) has the molecular formula C27H27FN2O5 and a molecular weight of 478.52 g/mol. Its IUPAC name is (3S,5S)-3,4-dibenzyl-5-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)piperazine-2,6-dione.
| Compound Name | (3S,5S)-3,4-dibenzyl-5-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)piperazine-2,6-dione |
|---|---|
| PubChem CID | 70686071 |
| Molecular Formula | C27H27FN2O5 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (3S,5S)-3,4-dibenzyl-5-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-(methoxymethoxy)piperazine-2,6-dione |
| SMILES | COCON1C(=O)[C@H]([C@H](O)c2ccc(F)cc2)N(Cc2ccccc2)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C27H27FN2O5/c1-34-18-35-30-26(32)23(16-19-8-4-2-5-9-19)29(17-20-10-6-3-7-11-20)24(27(30)33)25(31)21-12-14-22(28)15-13-21/h2-15,23-25,31H,16-18H2,1H3/t23-,24-,25+/m0/s1 |
| InChIKey | QIKUUMQSCDMHLP-CCDWMCETSA-N |
| XLogP | 3.25 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|